C25H33N3O7 — CID 57238838
ethyl 2-[4-ethoxy-2-(2-ethoxy-2-oxoethoxy)-5-ethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate (PubChem CID 57238838) has the molecular formula C25H33N3O7 and a molecular weight of 487.55 g/mol. Its IUPAC name is ethyl 2-[4-ethoxy-2-(2-ethoxy-2-oxoethoxy)-5-ethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate.
| Compound Name | ethyl 2-[4-ethoxy-2-(2-ethoxy-2-oxoethoxy)-5-ethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
|---|---|
| PubChem CID | 57238838 |
| Molecular Formula | C25H33N3O7 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | ethyl 2-[4-ethoxy-2-(2-ethoxy-2-oxoethoxy)-5-ethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
| SMILES | CCOC(=O)COc1cc(OCC)c(CC)cc1C(Nc1ccc(C(N)=NO)cc1)C(=O)OCC |
| InChI | InChI=1S/C25H33N3O7/c1-5-16-13-19(21(14-20(16)32-6-2)35-15-22(29)33-7-3)23(25(30)34-8-4)27-18-11-9-17(10-12-18)24(26)28-31/h9-14,23,27,31H,5-8,15H2,1-4H3,(H2,26,28) |
| InChIKey | RIHMBODNGHFIMT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|