C28H29F2N3O6 — CID 15967044
ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-[(Z)-N'-(4-fluorophenoxy)carbonylcarbamimidoyl]anilino]acetate (PubChem CID 15967044) has the molecular formula C28H29F2N3O6 and a molecular weight of 541.55 g/mol. Its IUPAC name is ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-[(Z)-N'-(4-fluorophenoxy)carbonylcarbamimidoyl]anilino]acetate.
| Compound Name | ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-[(Z)-N'-(4-fluorophenoxy)carbonylcarbamimidoyl]anilino]acetate |
|---|---|
| PubChem CID | 15967044 |
| Molecular Formula | C28H29F2N3O6 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-[(Z)-N'-(4-fluorophenoxy)carbonylcarbamimidoyl]anilino]acetate |
| SMILES | CCOC(=O)C(Nc1ccc(/C(N)=N/C(=O)Oc2ccc(F)cc2)cc1)c1cc(OCC)cc(OCC)c1F |
| InChI | InChI=1S/C28H29F2N3O6/c1-4-36-21-15-22(24(30)23(16-21)37-5-2)25(27(34)38-6-3)32-19-11-7-17(8-12-19)26(31)33-28(35)39-20-13-9-18(29)10-14-20/h7-16,25,32H,4-6H2,1-3H3,(H2,31,33,35) |
| InChIKey | CGZWIDGYLZLRQJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|