C19H21N4O6- — CID 22039483
2-[2-(2-amino-2-oxoethoxy)-5-ethoxyphenyl]-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetate (PubChem CID 22039483) has the molecular formula C19H21N4O6- and a molecular weight of 401.40 g/mol. Its IUPAC name is 2-[2-(2-amino-2-oxoethoxy)-5-ethoxyphenyl]-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetate.
| Compound Name | 2-[2-(2-amino-2-oxoethoxy)-5-ethoxyphenyl]-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetate |
|---|---|
| PubChem CID | 22039483 |
| Molecular Formula | C19H21N4O6- |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 2-[2-(2-amino-2-oxoethoxy)-5-ethoxyphenyl]-2-[4-[(E)-N'-hydroxycarbamimidoyl]anilino]acetate |
| SMILES | CCOc1ccc(OCC(N)=O)c(C(Nc2ccc(/C(N)=N\O)cc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C19H22N4O6/c1-2-28-13-7-8-15(29-10-16(20)24)14(9-13)17(19(25)26)22-12-5-3-11(4-6-12)18(21)23-27/h3-9,17,22,27H,2,10H2,1H3,(H2,20,24)(H2,21,23)(H,25,26)/p-1 |
| InChIKey | UHSCWLDYEXZAGE-UHFFFAOYSA-M |
| XLogP | -0.05 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|