C19H21N3O6 — CID 54556550
2-[2-(carboxymethoxy)-4,5-dimethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetic acid (PubChem CID 54556550) has the molecular formula C19H21N3O6 and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-4,5-dimethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-4,5-dimethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetic acid |
|---|---|
| PubChem CID | 54556550 |
| Molecular Formula | C19H21N3O6 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[2-(carboxymethoxy)-4,5-dimethylphenyl]-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)c(C(Nc2ccc(C(N)=NO)cc2)C(=O)O)cc1C |
| InChI | InChI=1S/C19H21N3O6/c1-10-7-14(15(8-11(10)2)28-9-16(23)24)17(19(25)26)21-13-5-3-12(4-6-13)18(20)22-27/h3-8,17,21,27H,9H2,1-2H3,(H2,20,22)(H,23,24)(H,25,26) |
| InChIKey | ZNOFRSRXJAREGW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|