C18H18BrN3O7 — CID 22039432
2-[5-bromo-2-(carboxymethoxy)-3-methoxyphenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid (PubChem CID 22039432) has the molecular formula C18H18BrN3O7 and a molecular weight of 468.26 g/mol. Its IUPAC name is 2-[5-bromo-2-(carboxymethoxy)-3-methoxyphenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid.
| Compound Name | 2-[5-bromo-2-(carboxymethoxy)-3-methoxyphenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid |
|---|---|
| PubChem CID | 22039432 |
| Molecular Formula | C18H18BrN3O7 |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-[5-bromo-2-(carboxymethoxy)-3-methoxyphenyl]-2-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]acetic acid |
| SMILES | COc1cc(Br)cc(C(Nc2ccc(/C(N)=N/O)cc2)C(=O)O)c1OCC(=O)O |
| InChI | InChI=1S/C18H18BrN3O7/c1-28-13-7-10(19)6-12(16(13)29-8-14(23)24)15(18(25)26)21-11-4-2-9(3-5-11)17(20)22-27/h2-7,15,21,27H,8H2,1H3,(H2,20,22)(H,23,24)(H,25,26) |
| InChIKey | QLCHQHYUTOGORF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 163.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|