C24H30N3O8- — CID 22040222
2-[4,5-diethoxy-2-[1-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-methoxy-2-oxoethyl]phenoxy]-2-methylpropanoate (PubChem CID 22040222) has the molecular formula C24H30N3O8- and a molecular weight of 488.52 g/mol. Its IUPAC name is 2-[4,5-diethoxy-2-[1-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-methoxy-2-oxoethyl]phenoxy]-2-methylpropanoate.
| Compound Name | 2-[4,5-diethoxy-2-[1-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-methoxy-2-oxoethyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 22040222 |
| Molecular Formula | C24H30N3O8- |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2-[4,5-diethoxy-2-[1-[4-[(Z)-N'-hydroxycarbamimidoyl]anilino]-2-methoxy-2-oxoethyl]phenoxy]-2-methylpropanoate |
| SMILES | CCOc1cc(OC(C)(C)C(=O)[O-])c(C(Nc2ccc(/C(N)=N/O)cc2)C(=O)OC)cc1OCC |
| InChI | InChI=1S/C24H31N3O8/c1-6-33-18-12-16(17(13-19(18)34-7-2)35-24(3,4)23(29)30)20(22(28)32-5)26-15-10-8-14(9-11-15)21(25)27-31/h8-13,20,26,31H,6-7H2,1-5H3,(H2,25,27)(H,29,30)/p-1 |
| InChIKey | QFRFNZRQABKETR-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 164.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|