C21H26FN3O5 — CID 85326005
ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate (PubChem CID 85326005) has the molecular formula C21H26FN3O5 and a molecular weight of 419.45 g/mol. Its IUPAC name is ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate.
| Compound Name | ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
|---|---|
| PubChem CID | 85326005 |
| Molecular Formula | C21H26FN3O5 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl 2-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]acetate |
| SMILES | CCOC(=O)C(Nc1ccc(C(N)=NO)cc1)c1cc(OCC)cc(OCC)c1F |
| InChI | InChI=1S/C21H26FN3O5/c1-4-28-15-11-16(18(22)17(12-15)29-5-2)19(21(26)30-6-3)24-14-9-7-13(8-10-14)20(23)25-27/h7-12,19,24,27H,4-6H2,1-3H3,(H2,23,25) |
| InChIKey | GQPONXGDRFRIBB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|