C22H28FN3O5 — CID 152712038
[1-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]propan-2-yl] acetate (PubChem CID 152712038) has the molecular formula C22H28FN3O5 and a molecular weight of 433.48 g/mol. Its IUPAC name is [1-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]propan-2-yl] acetate.
| Compound Name | [1-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]propan-2-yl] acetate |
|---|---|
| PubChem CID | 152712038 |
| Molecular Formula | C22H28FN3O5 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [1-(3,5-diethoxy-2-fluorophenyl)-2-[4-(N'-hydroxycarbamimidoyl)anilino]propan-2-yl] acetate |
| SMILES | CCOc1cc(CC(C)(Nc2ccc(C(N)=NO)cc2)OC(C)=O)c(F)c(OCC)c1 |
| InChI | InChI=1S/C22H28FN3O5/c1-5-29-18-11-16(20(23)19(12-18)30-6-2)13-22(4,31-14(3)27)25-17-9-7-15(8-10-17)21(24)26-28/h7-12,25,28H,5-6,13H2,1-4H3,(H2,24,26) |
| InChIKey | ZTUQQYPHZCVLPJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|