C41H39BrFN5O3 — CID 86607935
4-[(4-bromo-1-tritylimidazol-2-yl)-[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]-N'-hydroxybenzenecarboximidamide (PubChem CID 86607935) has the molecular formula C41H39BrFN5O3 and a molecular weight of 748.70 g/mol. Its IUPAC name is 4-[(4-bromo-1-tritylimidazol-2-yl)-[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[(4-bromo-1-tritylimidazol-2-yl)-[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 86607935 |
| Molecular Formula | C41H39BrFN5O3 |
| Molecular Weight | 748.70 g/mol |
| Exact Mass | 747.22 |
| IUPAC Name | 4-[(4-bromo-1-tritylimidazol-2-yl)-[(5-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]-N'-hydroxybenzenecarboximidamide |
| SMILES | CCOc1cc(CN(c2ccc(C(N)=NO)cc2)c2nc(Br)cn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c(OC(C)C)c1 |
| InChI | InChI=1S/C41H39BrFN5O3/c1-4-50-35-24-30(38(43)36(25-35)51-28(2)3)26-47(34-22-20-29(21-23-34)39(44)46-49)40-45-37(42)27-48(40)41(31-14-8-5-9-15-31,32-16-10-6-11-17-32)33-18-12-7-13-19-33/h5-25,27-28,49H,4,26H2,1-3H3,(H2,44,46) |
| InChIKey | DNKKWDJMAQJVMV-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.70 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|