C41H36BrFN4O2 — CID 69141287
4-[(4-bromo-1-tritylimidazol-2-yl)-[(4-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]benzonitrile (PubChem CID 69141287) has the molecular formula C41H36BrFN4O2 and a molecular weight of 715.67 g/mol. Its IUPAC name is 4-[(4-bromo-1-tritylimidazol-2-yl)-[(4-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]benzonitrile.
| Compound Name | 4-[(4-bromo-1-tritylimidazol-2-yl)-[(4-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 69141287 |
| Molecular Formula | C41H36BrFN4O2 |
| Molecular Weight | 715.67 g/mol |
| Exact Mass | 714.20 |
| IUPAC Name | 4-[(4-bromo-1-tritylimidazol-2-yl)-[(4-ethoxy-2-fluoro-3-propan-2-yloxyphenyl)methyl]amino]benzonitrile |
| SMILES | CCOc1ccc(CN(c2ccc(C#N)cc2)c2nc(Br)cn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1OC(C)C |
| InChI | InChI=1S/C41H36BrFN4O2/c1-4-48-36-25-22-31(38(43)39(36)49-29(2)3)27-46(35-23-20-30(26-44)21-24-35)40-45-37(42)28-47(40)41(32-14-8-5-9-15-32,33-16-10-6-11-17-33)34-18-12-7-13-19-34/h5-25,28-29H,4,27H2,1-3H3 |
| InChIKey | YVGZVAQGAOEURQ-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 63.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.67 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|