C44H37BrFN5O5 — CID 68815089
[6-[[(4-bromo-1-tritylimidazol-2-yl)-(3-ethoxy-5-ethyl-2-fluorophenyl)methyl]amino]isoquinolin-1-yl]-carboxycarbamic acid (PubChem CID 68815089) has the molecular formula C44H37BrFN5O5 and a molecular weight of 814.71 g/mol. Its IUPAC name is [6-[[(4-bromo-1-tritylimidazol-2-yl)-(3-ethoxy-5-ethyl-2-fluorophenyl)methyl]amino]isoquinolin-1-yl]-carboxycarbamic acid.
| Compound Name | [6-[[(4-bromo-1-tritylimidazol-2-yl)-(3-ethoxy-5-ethyl-2-fluorophenyl)methyl]amino]isoquinolin-1-yl]-carboxycarbamic acid |
|---|---|
| PubChem CID | 68815089 |
| Molecular Formula | C44H37BrFN5O5 |
| Molecular Weight | 814.71 g/mol |
| Exact Mass | 813.20 |
| IUPAC Name | [6-[[(4-bromo-1-tritylimidazol-2-yl)-(3-ethoxy-5-ethyl-2-fluorophenyl)methyl]amino]isoquinolin-1-yl]-carboxycarbamic acid |
| SMILES | CCOc1cc(CC)cc(C(Nc2ccc3c(N(C(=O)O)C(=O)O)nccc3c2)c2nc(Br)cn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1F |
| InChI | InChI=1S/C44H37BrFN5O5/c1-3-28-24-35(38(46)36(25-28)56-4-2)39(48-33-20-21-34-29(26-33)22-23-47-40(34)51(42(52)53)43(54)55)41-49-37(45)27-50(41)44(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-27,39,48H,3-4H2,1-2H3,(H,52,53)(H,54,55) |
| InChIKey | MVVFPXVERKJIPB-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.71 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|