C31H30F4N6O3 — CID 140507567
6-N-[(4-ethoxy-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid (PubChem CID 140507567) has the molecular formula C31H30F4N6O3 and a molecular weight of 610.61 g/mol. Its IUPAC name is 6-N-[(4-ethoxy-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-N-[(4-ethoxy-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 140507567 |
| Molecular Formula | C31H30F4N6O3 |
| Molecular Weight | 610.61 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 6-N-[(4-ethoxy-5-ethyl-2-fluorophenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCOc1cc(F)c(C(Nc2ccc3c(N)nccc3c2)c2nc(-c3ccccc3)nn2C)cc1CC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H29FN6O.C2HF3O2/c1-4-18-16-23(24(30)17-25(18)37-5-2)26(29-34-28(35-36(29)3)19-9-7-6-8-10-19)33-21-11-12-22-20(15-21)13-14-32-27(22)31;3-2(4,5)1(6)7/h6-17,26,33H,4-5H2,1-3H3,(H2,31,32);(H,6,7) |
| InChIKey | WXDBPVDSGSNAQZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |