C36H32F4N6O3 — CID 140507572
6-N-[(5-ethyl-2-fluoro-4-phenylmethoxyphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid (PubChem CID 140507572) has the molecular formula C36H32F4N6O3 and a molecular weight of 672.68 g/mol. Its IUPAC name is 6-N-[(5-ethyl-2-fluoro-4-phenylmethoxyphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-N-[(5-ethyl-2-fluoro-4-phenylmethoxyphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 140507572 |
| Molecular Formula | C36H32F4N6O3 |
| Molecular Weight | 672.68 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 6-N-[(5-ethyl-2-fluoro-4-phenylmethoxyphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]isoquinoline-1,6-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cc(C(Nc2ccc3c(N)nccc3c2)c2nc(-c3ccccc3)nn2C)c(F)cc1OCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H31FN6O.C2HF3O2/c1-3-23-19-28(29(35)20-30(23)42-21-22-10-6-4-7-11-22)31(34-39-33(40-41(34)2)24-12-8-5-9-13-24)38-26-14-15-27-25(18-26)16-17-37-32(27)36;3-2(4,5)1(6)7/h4-20,31,38H,3,21H2,1-2H3,(H2,36,37);(H,6,7) |
| InChIKey | JTFWQVLVEMWTFZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.68 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |