C27H24F4N6O2 — CID 173113812
[[amino-[4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-2-fluorophenyl]methylidene]amino] 2,2,2-trifluoroacetate (PubChem CID 173113812) has the molecular formula C27H24F4N6O2 and a molecular weight of 540.52 g/mol. Its IUPAC name is [[amino-[4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-2-fluorophenyl]methylidene]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[amino-[4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-2-fluorophenyl]methylidene]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 173113812 |
| Molecular Formula | C27H24F4N6O2 |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [[amino-[4-[[(3-ethylphenyl)-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]amino]-2-fluorophenyl]methylidene]amino] 2,2,2-trifluoroacetate |
| SMILES | CCc1cccc(C(Nc2ccc(C(N)=NOC(=O)C(F)(F)F)c(F)c2)c2nc(-c3ccccc3)nn2C)c1 |
| InChI | InChI=1S/C27H24F4N6O2/c1-3-16-8-7-11-18(14-16)22(25-34-24(35-37(25)2)17-9-5-4-6-10-17)33-19-12-13-20(21(28)15-19)23(32)36-39-26(38)27(29,30)31/h4-15,22,33H,3H2,1-2H3,(H2,32,36) |
| InChIKey | AWZPFFYVVBNPIM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|