C27H26F4N6O2 — CID 68816580
4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2-fluorobenzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68816580) has the molecular formula C27H26F4N6O2 and a molecular weight of 542.54 g/mol. Its IUPAC name is 4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2-fluorobenzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2-fluorobenzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68816580 |
| Molecular Formula | C27H26F4N6O2 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 4-[3-ethyl-N-[(2-methyl-5-phenyl-1,2,4-triazol-3-yl)methyl]anilino]-2-fluorobenzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N(Cc2nc(-c3ccccc3)nn2C)c2cccc(CC)c2)cc1F |
| InChI | InChI=1S/C25H25FN6.C2HF3O2/c1-3-17-8-7-11-19(14-17)32(20-12-13-21(24(27)28)22(26)15-20)16-23-29-25(30-31(23)2)18-9-5-4-6-10-18;3-2(4,5)1(6)7/h4-15H,3,16H2,1-2H3,(H3,27,28);(H,6,7) |
| InChIKey | VRWJBEPMSLRJCM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|