C27H25F4N5O2 — CID 68813318
4-[5-ethyl-2-fluoro-N-[(1-phenylpyrazol-3-yl)methyl]anilino]benzenecarboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 68813318) has the molecular formula C27H25F4N5O2 and a molecular weight of 527.52 g/mol. Its IUPAC name is 4-[5-ethyl-2-fluoro-N-[(1-phenylpyrazol-3-yl)methyl]anilino]benzenecarboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[5-ethyl-2-fluoro-N-[(1-phenylpyrazol-3-yl)methyl]anilino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68813318 |
| Molecular Formula | C27H25F4N5O2 |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 4-[5-ethyl-2-fluoro-N-[(1-phenylpyrazol-3-yl)methyl]anilino]benzenecarboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N(Cc2ccn(-c3ccccc3)n2)c2cc(CC)ccc2F)cc1 |
| InChI | InChI=1S/C25H24FN5.C2HF3O2/c1-2-18-8-13-23(26)24(16-18)30(21-11-9-19(10-12-21)25(27)28)17-20-14-15-31(29-20)22-6-4-3-5-7-22;3-2(4,5)1(6)7/h3-16H,2,17H2,1H3,(H3,27,28);(H,6,7) |
| InChIKey | KQVAXBLQJUDTFT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|