C28H26F4N6O3 — CID 68816160
2-[3-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]pyrazol-1-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 68816160) has the molecular formula C28H26F4N6O3 and a molecular weight of 570.55 g/mol. Its IUPAC name is 2-[3-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]pyrazol-1-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[3-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]pyrazol-1-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68816160 |
| Molecular Formula | C28H26F4N6O3 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 2-[3-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]pyrazol-1-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(c2ccc(F)c(CC)c2)c2ccn(-c3ccccc3C(N)=O)n2)cc1 |
| InChI | InChI=1S/C26H25FN6O.C2HF3O2/c1-2-16-15-18(9-12-21(16)27)24(31-19-10-7-17(8-11-19)25(28)29)22-13-14-33(32-22)23-6-4-3-5-20(23)26(30)34;3-2(4,5)1(6)7/h3-15,24,31H,2H2,1H3,(H3,28,29)(H2,30,34);(H,6,7) |
| InChIKey | XFXRBJIKMXGZTH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 160.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|