C30H27F7N6O5 — CID 87585267
2-[2-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]-1H-imidazol-5-yl]benzamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87585267) has the molecular formula C30H27F7N6O5 and a molecular weight of 684.57 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]-1H-imidazol-5-yl]benzamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[2-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]-1H-imidazol-5-yl]benzamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87585267 |
| Molecular Formula | C30H27F7N6O5 |
| Molecular Weight | 684.57 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | 2-[2-[(4-carbamimidoylanilino)-(3-ethyl-4-fluorophenyl)methyl]-1H-imidazol-5-yl]benzamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(c2ccc(F)c(CC)c2)c2ncc(-c3ccccc3C(N)=O)[nH]2)cc1 |
| InChI | InChI=1S/C26H25FN6O.2C2HF3O2/c1-2-15-13-17(9-12-21(15)27)23(32-18-10-7-16(8-11-18)24(28)29)26-31-14-22(33-26)19-5-3-4-6-20(19)25(30)34;2*3-2(4,5)1(6)7/h3-14,23,32H,2H2,1H3,(H3,28,29)(H2,30,34)(H,31,33);2*(H,6,7) |
| InChIKey | VATKRSXYMWYVCD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 208.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|