C28H27F3N6O4 — CID 161402931
2-[2-[(3-ethylphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-1H-imidazol-5-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 161402931) has the molecular formula C28H27F3N6O4 and a molecular weight of 568.56 g/mol. Its IUPAC name is 2-[2-[(3-ethylphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-1H-imidazol-5-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[(3-ethylphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-1H-imidazol-5-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161402931 |
| Molecular Formula | C28H27F3N6O4 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 2-[2-[(3-ethylphenyl)-[4-(N'-hydroxycarbamimidoyl)anilino]methyl]-1H-imidazol-5-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCc1cccc(C(Nc2ccc(C(N)=NO)cc2)c2ncc(-c3ccccc3C(N)=O)[nH]2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H26N6O2.C2HF3O2/c1-2-16-6-5-7-18(14-16)23(30-19-12-10-17(11-13-19)24(27)32-34)26-29-15-22(31-26)20-8-3-4-9-21(20)25(28)33;3-2(4,5)1(6)7/h3-15,23,30,34H,2H2,1H3,(H2,27,32)(H2,28,33)(H,29,31);(H,6,7) |
| InChIKey | VULVZNVYYHWHPP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 179.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|