C25H22F6N6O5 — CID 87951469
1-(4-carbamimidoylphenyl)-1-[2-(3-carbamimidoylphenyl)phenyl]urea;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87951469) has the molecular formula C25H22F6N6O5 and a molecular weight of 600.48 g/mol. Its IUPAC name is 1-(4-carbamimidoylphenyl)-1-[2-(3-carbamimidoylphenyl)phenyl]urea;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(4-carbamimidoylphenyl)-1-[2-(3-carbamimidoylphenyl)phenyl]urea;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87951469 |
| Molecular Formula | C25H22F6N6O5 |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 1-(4-carbamimidoylphenyl)-1-[2-(3-carbamimidoylphenyl)phenyl]urea;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N(C(N)=O)c2ccccc2-c2cccc(/C(N)=N/[H])c2)cc1 |
| InChI | InChI=1S/C21H20N6O.2C2HF3O2/c22-19(23)13-8-10-16(11-9-13)27(21(26)28)18-7-2-1-6-17(18)14-4-3-5-15(12-14)20(24)25;2*3-2(4,5)1(6)7/h1-12H,(H3,22,23)(H3,24,25)(H2,26,28);2*(H,6,7) |
| InChIKey | KFONEDCBDWTGAJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 220.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|