C22H22F3N3O5 — CID 67652029
2-[4-(3-carbamimidoylphenyl)-3-ethyl-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 67652029) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is 2-[4-(3-carbamimidoylphenyl)-3-ethyl-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(3-carbamimidoylphenyl)-3-ethyl-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67652029 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[4-(3-carbamimidoylphenyl)-3-ethyl-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc(C2c3ccccc3C(=O)N(CC(=O)O)C2CC)c1 |
| InChI | InChI=1S/C20H21N3O3.C2HF3O2/c1-2-16-18(12-6-5-7-13(10-12)19(21)22)14-8-3-4-9-15(14)20(26)23(16)11-17(24)25;3-2(4,5)1(6)7/h3-10,16,18H,2,11H2,1H3,(H3,21,22)(H,24,25);(H,6,7) |
| InChIKey | RRRIRIQKDHHHNK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|