C26H21F6N3O3 — CID 10165657
cis-(1R,2S)-2-(3-carbamimidoylphenyl)-N-[4-[2-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 10165657) has the molecular formula C26H21F6N3O3 and a molecular weight of 537.46 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-carbamimidoylphenyl)-N-[4-[2-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | cis-(1R,2S)-2-(3-carbamimidoylphenyl)-N-[4-[2-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10165657 |
| Molecular Formula | C26H21F6N3O3 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | cis-(1R,2S)-2-(3-carbamimidoylphenyl)-N-[4-[2-(trifluoromethyl)phenyl]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cccc([C@H]2C[C@H]2C(=O)Nc2ccc(-c3ccccc3C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H20F3N3O.C2HF3O2/c25-24(26,27)21-7-2-1-6-18(21)14-8-10-17(11-9-14)30-23(31)20-13-19(20)15-4-3-5-16(12-15)22(28)29;3-2(4,5)1(6)7/h1-12,19-20H,13H2,(H3,28,29)(H,30,31);(H,6,7)/t19-,20-;/m1./s1 |
| InChIKey | WENHOGHNTDMNCI-GZJHNZOKSA-N |
| XLogP | 6.03 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|