C20H17N3O3 — CID 15483872
2-[6-[2-(3-carbamimidoylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid (PubChem CID 15483872) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[6-[2-(3-carbamimidoylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid.
| Compound Name | 2-[6-[2-(3-carbamimidoylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 15483872 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[6-[2-(3-carbamimidoylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1cccc(C#Cc2ccc3c(c2)CCN(CC(=O)O)C3=O)c1 |
| InChI | InChI=1S/C20H17N3O3/c21-19(22)16-3-1-2-13(11-16)4-5-14-6-7-17-15(10-14)8-9-23(20(17)26)12-18(24)25/h1-3,6-7,10-11H,8-9,12H2,(H3,21,22)(H,24,25) |
| InChIKey | JLABQTMUQZAPIB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|