C24H24N2O3S — CID 10574157
tert-butyl 2-[6-[2-(4-carbamothioylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate (PubChem CID 10574157) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is tert-butyl 2-[6-[2-(4-carbamothioylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate.
| Compound Name | tert-butyl 2-[6-[2-(4-carbamothioylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate |
|---|---|
| PubChem CID | 10574157 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl 2-[6-[2-(4-carbamothioylphenyl)ethynyl]-1-oxo-3,4-dihydroisoquinolin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCc2cc(C#Cc3ccc(C(N)=S)cc3)ccc2C1=O |
| InChI | InChI=1S/C24H24N2O3S/c1-24(2,3)29-21(27)15-26-13-12-19-14-17(8-11-20(19)23(26)28)5-4-16-6-9-18(10-7-16)22(25)30/h6-11,14H,12-13,15H2,1-3H3,(H2,25,30) |
| InChIKey | VJEBZYRCDXIMBY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|