C17H13F3N2O3S — CID 161247886
4-(2-hydroxyphenyl)-1-benzothiophene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 161247886) has the molecular formula C17H13F3N2O3S and a molecular weight of 382.36 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-1-benzothiophene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2-hydroxyphenyl)-1-benzothiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161247886 |
| Molecular Formula | C17H13F3N2O3S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-(2-hydroxyphenyl)-1-benzothiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc2c(-c3ccccc3O)cccc2s1 |
| InChI | InChI=1S/C15H12N2OS.C2HF3O2/c16-15(17)14-8-11-9(5-3-7-13(11)19-14)10-4-1-2-6-12(10)18;3-2(4,5)1(6)7/h1-8,18H,(H3,16,17);(H,6,7) |
| InChIKey | YGNWPIAEIICWTA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|