C20H18F3N3O4S2 — CID 135828204
5-amino-4-[3-(2-methylphenyl)phenyl]sulfonylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 135828204) has the molecular formula C20H18F3N3O4S2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 5-amino-4-[3-(2-methylphenyl)phenyl]sulfonylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-amino-4-[3-(2-methylphenyl)phenyl]sulfonylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135828204 |
| Molecular Formula | C20H18F3N3O4S2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 5-amino-4-[3-(2-methylphenyl)phenyl]sulfonylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3ccccc3C)c2)c(N)s1 |
| InChI | InChI=1S/C18H17N3O2S2.C2HF3O2/c1-11-5-2-3-8-14(11)12-6-4-7-13(9-12)25(22,23)16-10-15(17(19)20)24-18(16)21;3-2(4,5)1(6)7/h2-10H,21H2,1H3,(H3,19,20);(H,6,7) |
| InChIKey | SDXDPMBIEANQGT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 147.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|