C26H31N5O5S3 — CID 58700465
(2S)-2-amino-6-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]carbamoylamino]hexanoic acid (PubChem CID 58700465) has the molecular formula C26H31N5O5S3 and a molecular weight of 589.77 g/mol. Its IUPAC name is (2S)-2-amino-6-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 58700465 |
| Molecular Formula | C26H31N5O5S3 |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.15 |
| IUPAC Name | (2S)-2-amino-6-[[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]carbamoylamino]hexanoic acid |
| SMILES | [H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3c(C)cccc3NC(=O)NCCCC[C@H](N)C(=O)O)c2)c(SC)s1 |
| InChI | InChI=1S/C26H31N5O5S3/c1-15-7-5-11-19(31-26(34)30-12-4-3-10-18(27)24(32)33)22(15)16-8-6-9-17(13-16)39(35,36)21-14-20(23(28)29)38-25(21)37-2/h5-9,11,13-14,18H,3-4,10,12,27H2,1-2H3,(H3,28,29)(H,32,33)(H2,30,31,34)/t18-/m0/s1 |
| InChIKey | YSKYIEBKVCQNHA-SFHVURJKSA-N |
| XLogP | 4.27 |
| TPSA | 188.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|