C28H34F3N7O7S4 — CID 10055940
1-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylphenyl]-3-(4-methylsulfonylbutyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 10055940) has the molecular formula C28H34F3N7O7S4 and a molecular weight of 765.88 g/mol. Its IUPAC name is 1-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylphenyl]-3-(4-methylsulfonylbutyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylphenyl]-3-(4-methylsulfonylbutyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10055940 |
| Molecular Formula | C28H34F3N7O7S4 |
| Molecular Weight | 765.88 g/mol |
| Exact Mass | 765.14 |
| IUPAC Name | 1-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-5-(diaminomethylideneamino)-3-methylphenyl]-3-(4-methylsulfonylbutyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3c(C)cc(N=C(N)N)cc3NC(=O)NCCCCS(C)(=O)=O)c2)c(SC)s1 |
| InChI | InChI=1S/C26H33N7O5S4.C2HF3O2/c1-15-11-17(32-25(29)30)13-19(33-26(34)31-9-4-5-10-41(3,35)36)22(15)16-7-6-8-18(12-16)42(37,38)21-14-20(23(27)28)40-24(21)39-2;3-2(4,5)1(6)7/h6-8,11-14H,4-5,9-10H2,1-3H3,(H3,27,28)(H4,29,30,32)(H2,31,33,34);(H,6,7) |
| InChIKey | STTQUORLVKVXEA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 260.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|