C20H17BrF3N3O3S3 — CID 11852588
4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 11852588) has the molecular formula C20H17BrF3N3O3S3 and a molecular weight of 580.47 g/mol. Its IUPAC name is 4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11852588 |
| Molecular Formula | C20H17BrF3N3O3S3 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 578.96 |
| IUPAC Name | 4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1cc(S(=O)(=Nc2ccccc2)c2cccc(Br)c2)c(SC)s1 |
| InChI | InChI=1S/C18H16BrN3OS3.C2HF3O2/c1-24-18-16(11-15(25-18)17(20)21)26(23,14-9-5-6-12(19)10-14)22-13-7-3-2-4-8-13;3-2(4,5)1(6)7/h2-11H,1H3,(H3,20,21);(H,6,7) |
| InChIKey | YESKGGWCUXCBPT-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|