C18H17BN4O3S4 — CID 88983513
CID 88983513 (PubChem CID 88983513) has the molecular formula C18H17BN4O3S4 and a molecular weight of 476.44 g/mol.
| Compound Name | CID 88983513 |
|---|---|
| PubChem CID | 88983513 |
| Molecular Formula | C18H17BN4O3S4 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\N)c1cc(S(=O)(=NS(=O)(=O)c2cccc(N)c2)c2cccc([B])c2)c(SC)s1 |
| InChI | InChI=1S/C18H17BN4O3S4/c1-27-18-16(10-15(28-18)17(21)22)29(24,13-6-2-4-11(19)8-13)23-30(25,26)14-7-3-5-12(20)9-14/h2-10H,20H2,1H3,(H3,21,22) |
| InChIKey | VDQYBBZVVXNDSG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|