C32H36N4O5S4 — CID 157201041
tert-butyl N-[4-[N-(3-aminophenyl)sulfonyl-S-[3-(2,4,6-trimethylphenyl)phenyl]sulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidoyl]carbamate (PubChem CID 157201041) has the molecular formula C32H36N4O5S4 and a molecular weight of 684.93 g/mol. Its IUPAC name is tert-butyl N-[4-[N-(3-aminophenyl)sulfonyl-S-[3-(2,4,6-trimethylphenyl)phenyl]sulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidoyl]carbamate.
| Compound Name | tert-butyl N-[4-[N-(3-aminophenyl)sulfonyl-S-[3-(2,4,6-trimethylphenyl)phenyl]sulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidoyl]carbamate |
|---|---|
| PubChem CID | 157201041 |
| Molecular Formula | C32H36N4O5S4 |
| Molecular Weight | 684.93 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | tert-butyl N-[4-[N-(3-aminophenyl)sulfonyl-S-[3-(2,4,6-trimethylphenyl)phenyl]sulfonimidoyl]-5-methylsulfanylthiophene-2-carboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cc(S(=O)(=NS(=O)(=O)c2cccc(N)c2)c2cccc(-c3c(C)cc(C)cc3C)c2)c(SC)s1 |
| InChI | InChI=1S/C32H36N4O5S4/c1-19-14-20(2)28(21(3)15-19)22-10-8-12-24(16-22)44(38,36-45(39,40)25-13-9-11-23(33)17-25)27-18-26(43-30(27)42-7)29(34)35-31(37)41-32(4,5)6/h8-18H,33H2,1-7H3,(H2,34,35,37) |
| InChIKey | AQUKTODQFLNJBG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 151.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.93 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|