C31H39N5O7S3 — CID 173202536
6-[[3-amino-5-methyl-2-[5-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-2-methylsulfanylthiophen-3-yl]sulfonyl-6-phenylphenyl]carbamoylamino]hexanoic acid (PubChem CID 173202536) has the molecular formula C31H39N5O7S3 and a molecular weight of 689.88 g/mol. Its IUPAC name is 6-[[3-amino-5-methyl-2-[5-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-2-methylsulfanylthiophen-3-yl]sulfonyl-6-phenylphenyl]carbamoylamino]hexanoic acid.
| Compound Name | 6-[[3-amino-5-methyl-2-[5-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-2-methylsulfanylthiophen-3-yl]sulfonyl-6-phenylphenyl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 173202536 |
| Molecular Formula | C31H39N5O7S3 |
| Molecular Weight | 689.88 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | 6-[[3-amino-5-methyl-2-[5-[N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-2-methylsulfanylthiophen-3-yl]sulfonyl-6-phenylphenyl]carbamoylamino]hexanoic acid |
| SMILES | [H]/N=C(\NC(=O)OC(C)(C)C)c1cc(S(=O)(=O)c2c(N)cc(C)c(-c3ccccc3)c2NC(=O)NCCCCCC(=O)O)c(SC)s1 |
| InChI | InChI=1S/C31H39N5O7S3/c1-18-16-20(32)26(46(41,42)22-17-21(45-28(22)44-5)27(33)36-30(40)43-31(2,3)4)25(24(18)19-12-8-6-9-13-19)35-29(39)34-15-11-7-10-14-23(37)38/h6,8-9,12-13,16-17H,7,10-11,14-15,32H2,1-5H3,(H,37,38)(H2,33,36,40)(H2,34,35,39) |
| InChIKey | CXOXVJJGHSUFDK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 200.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.88 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|