C49H50N8O5S3 — CID 86590791
tert-butyl N-[amino-[5-methylsulfanyl-4-[3-[2-methyl-6-[4-(2-trityltetrazol-5-yl)butylcarbamoylamino]phenyl]phenyl]sulfonylthiophen-2-yl]methylidene]carbamate (PubChem CID 86590791) has the molecular formula C49H50N8O5S3 and a molecular weight of 927.19 g/mol. Its IUPAC name is tert-butyl N-[amino-[5-methylsulfanyl-4-[3-[2-methyl-6-[4-(2-trityltetrazol-5-yl)butylcarbamoylamino]phenyl]phenyl]sulfonylthiophen-2-yl]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[5-methylsulfanyl-4-[3-[2-methyl-6-[4-(2-trityltetrazol-5-yl)butylcarbamoylamino]phenyl]phenyl]sulfonylthiophen-2-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 86590791 |
| Molecular Formula | C49H50N8O5S3 |
| Molecular Weight | 927.19 g/mol |
| Exact Mass | 926.31 |
| IUPAC Name | tert-butyl N-[amino-[5-methylsulfanyl-4-[3-[2-methyl-6-[4-(2-trityltetrazol-5-yl)butylcarbamoylamino]phenyl]phenyl]sulfonylthiophen-2-yl]methylidene]carbamate |
| SMILES | CSc1sc(C(N)=NC(=O)OC(C)(C)C)cc1S(=O)(=O)c1cccc(-c2c(C)cccc2NC(=O)NCCCCc2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C49H50N8O5S3/c1-33-19-17-28-39(43(33)34-20-18-27-38(31-34)65(60,61)41-32-40(64-45(41)63-5)44(50)53-47(59)62-48(2,3)4)52-46(58)51-30-16-15-29-42-54-56-57(55-42)49(35-21-9-6-10-22-35,36-23-11-7-12-24-36)37-25-13-8-14-26-37/h6-14,17-28,31-32H,15-16,29-30H2,1-5H3,(H2,50,53,59)(H2,51,52,58) |
| InChIKey | JVDSZQBEVVDYRP-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 183.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.19 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|