C23H25N5O5S3 — CID 152773149
[4-[3-[2-(2-aminoethylcarbamoylamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidoyl]carbamic acid (PubChem CID 152773149) has the molecular formula C23H25N5O5S3 and a molecular weight of 547.68 g/mol. Its IUPAC name is [4-[3-[2-(2-aminoethylcarbamoylamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidoyl]carbamic acid.
| Compound Name | [4-[3-[2-(2-aminoethylcarbamoylamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidoyl]carbamic acid |
|---|---|
| PubChem CID | 152773149 |
| Molecular Formula | C23H25N5O5S3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | [4-[3-[2-(2-aminoethylcarbamoylamino)-6-methylphenyl]phenyl]sulfonyl-5-methylsulfanylthiophene-2-carboximidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)c1cc(S(=O)(=O)c2cccc(-c3c(C)cccc3NC(=O)NCCN)c2)c(SC)s1 |
| InChI | InChI=1S/C23H25N5O5S3/c1-13-5-3-8-16(27-22(29)26-10-9-24)19(13)14-6-4-7-15(11-14)36(32,33)18-12-17(35-21(18)34-2)20(25)28-23(30)31/h3-8,11-12H,9-10,24H2,1-2H3,(H2,25,28)(H,30,31)(H2,26,27,29) |
| InChIKey | BUQILNPRZUYIKU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 174.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|