C30H40N4O2S3 — CID 67564348
11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfinylphenyl]-3-methylphenyl]undecanamide (PubChem CID 67564348) has the molecular formula C30H40N4O2S3 and a molecular weight of 584.88 g/mol. Its IUPAC name is 11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfinylphenyl]-3-methylphenyl]undecanamide.
| Compound Name | 11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfinylphenyl]-3-methylphenyl]undecanamide |
|---|---|
| PubChem CID | 67564348 |
| Molecular Formula | C30H40N4O2S3 |
| Molecular Weight | 584.88 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfinylphenyl]-3-methylphenyl]undecanamide |
| SMILES | [H]/N=C(\N)c1cc(S(=O)c2cccc(-c3c(C)cccc3NC(=O)CCCCCCCCCCN)c2)c(SC)s1 |
| InChI | InChI=1S/C30H40N4O2S3/c1-21-13-11-16-24(34-27(35)17-9-7-5-3-4-6-8-10-18-31)28(21)22-14-12-15-23(19-22)39(36)26-20-25(29(32)33)38-30(26)37-2/h11-16,19-20H,3-10,17-18,31H2,1-2H3,(H3,32,33)(H,34,35) |
| InChIKey | YEFTYYFKELHPLK-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.88 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|