C28H28N6O2S4 — CID 70074081
N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)benzamide;(E)-N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-3-phenylprop-2-enamide (PubChem CID 70074081) has the molecular formula C28H28N6O2S4 and a molecular weight of 608.84 g/mol. Its IUPAC name is N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)benzamide;(E)-N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-3-phenylprop-2-enamide.
| Compound Name | N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)benzamide;(E)-N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 70074081 |
| Molecular Formula | C28H28N6O2S4 |
| Molecular Weight | 608.84 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)benzamide;(E)-N-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-3-phenylprop-2-enamide |
| SMILES | [H]/N=C(\N)c1cc(NC(=O)/C=C/c2ccccc2)c(SC)s1.[H]/N=C(\N)c1cc(NC(=O)c2ccccc2)c(SC)s1 |
| InChI | InChI=1S/C15H15N3OS2.C13H13N3OS2/c1-20-15-11(9-12(21-15)14(16)17)18-13(19)8-7-10-5-3-2-4-6-10;1-18-13-9(7-10(19-13)11(14)15)16-12(17)8-5-3-2-4-6-8/h2-9H,1H3,(H3,16,17)(H,18,19);2-7H,1H3,(H3,14,15)(H,16,17)/b8-7+; |
| InChIKey | OXMYFSCPIWEMEU-USRGLUTNSA-N |
| XLogP | 6.41 |
| TPSA | 157.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.84 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|