C22H19NO2S2 — CID 121132013
(E)-N-[(5-benzoylthiophen-2-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide (PubChem CID 121132013) has the molecular formula C22H19NO2S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is (E)-N-[(5-benzoylthiophen-2-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(5-benzoylthiophen-2-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121132013 |
| Molecular Formula | C22H19NO2S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | (E)-N-[(5-benzoylthiophen-2-yl)methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)NCc2ccc(C(=O)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C22H19NO2S2/c1-26-18-10-7-16(8-11-18)9-14-21(24)23-15-19-12-13-20(27-19)22(25)17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,23,24)/b14-9+ |
| InChIKey | CKKVEVYZNIWPTJ-NTEUORMPSA-N |
| XLogP | 5.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|