C20H17NO2S3 — CID 72717700
(E)-3-(4-methylsulfanylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]prop-2-enamide (PubChem CID 72717700) has the molecular formula C20H17NO2S3 and a molecular weight of 399.56 g/mol. Its IUPAC name is (E)-3-(4-methylsulfanylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methylsulfanylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 72717700 |
| Molecular Formula | C20H17NO2S3 |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | (E)-3-(4-methylsulfanylphenyl)-N-[[5-(thiophene-3-carbonyl)thiophen-2-yl]methyl]prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)NCc2ccc(C(=O)c3ccsc3)s2)cc1 |
| InChI | InChI=1S/C20H17NO2S3/c1-24-16-5-2-14(3-6-16)4-9-19(22)21-12-17-7-8-18(26-17)20(23)15-10-11-25-13-15/h2-11,13H,12H2,1H3,(H,21,22)/b9-4+ |
| InChIKey | RYZPHSKSWAOACE-RUDMXATFSA-N |
| XLogP | 5.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|