C20H21NO2S — CID 99709526
(E)-N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide (PubChem CID 99709526) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is (E)-N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 99709526 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (E)-N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-3-(4-methylsulfanylphenyl)prop-2-enamide |
| SMILES | CSc1ccc(/C=C/C(=O)NC[C@]2(O)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-24-17-9-6-15(7-10-17)8-11-19(22)21-14-20(23)13-12-16-4-2-3-5-18(16)20/h2-11,23H,12-14H2,1H3,(H,21,22)/b11-8+/t20-/m1/s1 |
| InChIKey | HTJVKZRKXHWVIM-OJLWIZQOSA-N |
| XLogP | 3.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|