C31H44N4O3S3 — CID 161372647
11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]undecanamide;methane (PubChem CID 161372647) has the molecular formula C31H44N4O3S3 and a molecular weight of 616.92 g/mol. Its IUPAC name is 11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]undecanamide;methane.
| Compound Name | 11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]undecanamide;methane |
|---|---|
| PubChem CID | 161372647 |
| Molecular Formula | C31H44N4O3S3 |
| Molecular Weight | 616.92 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | 11-amino-N-[2-[3-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)sulfonylphenyl]-3-methylphenyl]undecanamide;methane |
| SMILES | C.[H]/N=C(\N)c1cc(S(=O)(=O)c2cccc(-c3c(C)cccc3NC(=O)CCCCCCCCCCN)c2)c(SC)s1 |
| InChI | InChI=1S/C30H40N4O3S3.CH4/c1-21-13-11-16-24(34-27(35)17-9-7-5-3-4-6-8-10-18-31)28(21)22-14-12-15-23(19-22)40(36,37)26-20-25(29(32)33)39-30(26)38-2;/h11-16,19-20H,3-10,17-18,31H2,1-2H3,(H3,32,33)(H,34,35);1H4 |
| InChIKey | VQQZAEKBBHVKNF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.92 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|