C23H24BrN3O3S3 — CID 59733687
tert-butyl (NZ)-N-[amino-[4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophen-2-yl]methylidene]carbamate (PubChem CID 59733687) has the molecular formula C23H24BrN3O3S3 and a molecular weight of 566.57 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino-[4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophen-2-yl]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[amino-[4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophen-2-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 59733687 |
| Molecular Formula | C23H24BrN3O3S3 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 565.02 |
| IUPAC Name | tert-butyl (NZ)-N-[amino-[4-[S-(3-bromophenyl)-N-phenylsulfonimidoyl]-5-methylsulfanylthiophen-2-yl]methylidene]carbamate |
| SMILES | CSc1sc(/C(N)=N/C(=O)OC(C)(C)C)cc1S(=O)(=Nc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H24BrN3O3S3/c1-23(2,3)30-22(28)26-20(25)18-14-19(21(31-4)32-18)33(29,17-12-8-9-15(24)13-17)27-16-10-6-5-7-11-16/h5-14H,1-4H3,(H2,25,26,28) |
| InChIKey | KPIMVLXIXNOCAU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|