C24H31N3O3S — CID 143528711
tert-butyl (NZ)-N-[amino-[4-(2-amino-1-phenylethoxy)-1-benzothiophen-2-yl]methylidene]carbamate;ethane (PubChem CID 143528711) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino-[4-(2-amino-1-phenylethoxy)-1-benzothiophen-2-yl]methylidene]carbamate;ethane.
| Compound Name | tert-butyl (NZ)-N-[amino-[4-(2-amino-1-phenylethoxy)-1-benzothiophen-2-yl]methylidene]carbamate;ethane |
|---|---|
| PubChem CID | 143528711 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | tert-butyl (NZ)-N-[amino-[4-(2-amino-1-phenylethoxy)-1-benzothiophen-2-yl]methylidene]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)/N=C(\N)c1cc2c(OC(CN)c3ccccc3)cccc2s1 |
| InChI | InChI=1S/C22H25N3O3S.C2H6/c1-22(2,3)28-21(26)25-20(24)19-12-15-16(10-7-11-18(15)29-19)27-17(13-23)14-8-5-4-6-9-14;1-2/h4-12,17H,13,23H2,1-3H3,(H2,24,25,26);1-2H3 |
| InChIKey | OOVBDODAERXXIP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|