C24H21N3O3S — CID 45103481
2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-N-(3-methoxyphenyl)-2-phenylacetamide (PubChem CID 45103481) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-N-(3-methoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-N-(3-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 45103481 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-N-(3-methoxyphenyl)-2-phenylacetamide |
| SMILES | [H]/N=C(\N)c1cc2c(OC(C(=O)Nc3cccc(OC)c3)c3ccccc3)cccc2s1 |
| InChI | InChI=1S/C24H21N3O3S/c1-29-17-10-5-9-16(13-17)27-24(28)22(15-7-3-2-4-8-15)30-19-11-6-12-20-18(19)14-21(31-20)23(25)26/h2-14,22H,1H3,(H3,25,26)(H,27,28) |
| InChIKey | COPFNINVTDIILJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|