C26H24N4O3S — CID 46233491
4-[[2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-2-phenylacetyl]amino]-N,N-dimethylbenzamide (PubChem CID 46233491) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-[[2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-2-phenylacetyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[[2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-2-phenylacetyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 46233491 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-[[2-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-2-phenylacetyl]amino]-N,N-dimethylbenzamide |
| SMILES | [H]/N=C(\N)c1cc2c(OC(C(=O)Nc3ccc(C(=O)N(C)C)cc3)c3ccccc3)cccc2s1 |
| InChI | InChI=1S/C26H24N4O3S/c1-30(2)26(32)17-11-13-18(14-12-17)29-25(31)23(16-7-4-3-5-8-16)33-20-9-6-10-21-19(20)15-22(34-21)24(27)28/h3-15,23H,1-2H3,(H3,27,28)(H,29,31) |
| InChIKey | SVDSEBLMCDOJKU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|