C22H25N3O4S — CID 158898991
N-[(1S,2S)-1-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-1-phenylpropan-2-yl]-N-methylacetamide;formic acid (PubChem CID 158898991) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[(1S,2S)-1-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-1-phenylpropan-2-yl]-N-methylacetamide;formic acid.
| Compound Name | N-[(1S,2S)-1-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-1-phenylpropan-2-yl]-N-methylacetamide;formic acid |
|---|---|
| PubChem CID | 158898991 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[(1S,2S)-1-[(2-carbamimidoyl-1-benzothiophen-4-yl)oxy]-1-phenylpropan-2-yl]-N-methylacetamide;formic acid |
| SMILES | O=CO.[H]/N=C(\N)c1cc2c(O[C@@H](c3ccccc3)[C@H](C)N(C)C(C)=O)cccc2s1 |
| InChI | InChI=1S/C21H23N3O2S.CH2O2/c1-13(24(3)14(2)25)20(15-8-5-4-6-9-15)26-17-10-7-11-18-16(17)12-19(27-18)21(22)23;2-1-3/h4-13,20H,1-3H3,(H3,22,23);1H,(H,2,3)/t13-,20+;/m0./s1 |
| InChIKey | JFEOTGWSLPNHCR-IAJYROFQSA-N |
| XLogP | 3.87 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|