C15H19ClN2S — CID 67850388
4-(4-methylpent-1-enyl)-1-benzothiophene-2-carboximidamide;hydrochloride (PubChem CID 67850388) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is 4-(4-methylpent-1-enyl)-1-benzothiophene-2-carboximidamide;hydrochloride.
| Compound Name | 4-(4-methylpent-1-enyl)-1-benzothiophene-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 67850388 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(4-methylpent-1-enyl)-1-benzothiophene-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cc2c(C=CCC(C)C)cccc2s1 |
| InChI | InChI=1S/C15H18N2S.ClH/c1-10(2)5-3-6-11-7-4-8-13-12(11)9-14(18-13)15(16)17;/h3-4,6-10H,5H2,1-2H3,(H3,16,17);1H |
| InChIKey | YSWQMYOTXBJRJT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|