C12H13ClN2S2 — CID 19007354
4-prop-2-enylsulfanyl-1-benzothiophene-2-carboximidamide;hydrochloride (PubChem CID 19007354) has the molecular formula C12H13ClN2S2 and a molecular weight of 284.84 g/mol. Its IUPAC name is 4-prop-2-enylsulfanyl-1-benzothiophene-2-carboximidamide;hydrochloride.
| Compound Name | 4-prop-2-enylsulfanyl-1-benzothiophene-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 19007354 |
| Molecular Formula | C12H13ClN2S2 |
| Molecular Weight | 284.84 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-prop-2-enylsulfanyl-1-benzothiophene-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cc2c(SCC=C)cccc2s1 |
| InChI | InChI=1S/C12H12N2S2.ClH/c1-2-6-15-9-4-3-5-10-8(9)7-11(16-10)12(13)14;/h2-5,7H,1,6H2,(H3,13,14);1H |
| InChIKey | IWWLDKVGGNUFEV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|