C21H17ClN2O5 — CID 7865797
(2S)-2-(2-chloro-4-nitrophenoxy)-N-(3-methoxyphenyl)-2-phenylacetamide (PubChem CID 7865797) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is (2S)-2-(2-chloro-4-nitrophenoxy)-N-(3-methoxyphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(2-chloro-4-nitrophenoxy)-N-(3-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 7865797 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (2S)-2-(2-chloro-4-nitrophenoxy)-N-(3-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1cccc(NC(=O)[C@@H](Oc2ccc([N+](=O)[O-])cc2Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C21H17ClN2O5/c1-28-17-9-5-8-15(12-17)23-21(25)20(14-6-3-2-4-7-14)29-19-11-10-16(24(26)27)13-18(19)22/h2-13,20H,1H3,(H,23,25)/t20-/m0/s1 |
| InChIKey | XAOMLXICODEOLJ-FQEVSTJZSA-N |
| XLogP | 5.02 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|