C17H19BrN2O4S3 — CID 68955268
tert-butyl N-[[4-(3-bromophenyl)sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate (PubChem CID 68955268) has the molecular formula C17H19BrN2O4S3 and a molecular weight of 491.45 g/mol. Its IUPAC name is tert-butyl N-[[4-(3-bromophenyl)sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate.
| Compound Name | tert-butyl N-[[4-(3-bromophenyl)sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate |
|---|---|
| PubChem CID | 68955268 |
| Molecular Formula | C17H19BrN2O4S3 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | tert-butyl N-[[4-(3-bromophenyl)sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate |
| SMILES | CSc1sc(N=CNC(=O)OC(C)(C)C)cc1S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H19BrN2O4S3/c1-17(2,3)24-16(21)20-10-19-14-9-13(15(25-4)26-14)27(22,23)12-7-5-6-11(18)8-12/h5-10H,1-4H3,(H,19,20,21) |
| InChIKey | UODDQSIPPWHYJV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|