C24H27N3O4S3 — CID 87900359
tert-butyl N-[(E)-[4-[3-(4-amino-2-methylphenyl)phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate (PubChem CID 87900359) has the molecular formula C24H27N3O4S3 and a molecular weight of 517.70 g/mol. Its IUPAC name is tert-butyl N-[(E)-[4-[3-(4-amino-2-methylphenyl)phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate.
| Compound Name | tert-butyl N-[(E)-[4-[3-(4-amino-2-methylphenyl)phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate |
|---|---|
| PubChem CID | 87900359 |
| Molecular Formula | C24H27N3O4S3 |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | tert-butyl N-[(E)-[4-[3-(4-amino-2-methylphenyl)phenyl]sulfonyl-5-methylsulfanylthiophen-2-yl]iminomethyl]carbamate |
| SMILES | CSc1sc(/N=C/NC(=O)OC(C)(C)C)cc1S(=O)(=O)c1cccc(-c2ccc(N)cc2C)c1 |
| InChI | InChI=1S/C24H27N3O4S3/c1-15-11-17(25)9-10-19(15)16-7-6-8-18(12-16)34(29,30)20-13-21(33-22(20)32-5)26-14-27-23(28)31-24(2,3)4/h6-14H,25H2,1-5H3,(H,26,27,28) |
| InChIKey | KAVUYAONPMCVHG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|